C12H20ClN3 — CID 106117297
N-[2-(2-chloroethyl)pentyl]-2-methylpyrimidin-4-amine (PubChem CID 106117297) has the molecular formula C12H20ClN3 and a molecular weight of 241.77 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)pentyl]-2-methylpyrimidin-4-amine.
| Compound Name | N-[2-(2-chloroethyl)pentyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106117297 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-[2-(2-chloroethyl)pentyl]-2-methylpyrimidin-4-amine |
| SMILES | CCCC(CCCl)CNc1ccnc(C)n1 |
| InChI | InChI=1S/C12H20ClN3/c1-3-4-11(5-7-13)9-15-12-6-8-14-10(2)16-12/h6,8,11H,3-5,7,9H2,1-2H3,(H,14,15,16) |
| InChIKey | LCHRVMRJMWJHEV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|