C10H17N3 — CID 62769511
2-methyl-N-(2-methylbutyl)pyrimidin-4-amine (PubChem CID 62769511) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-methyl-N-(2-methylbutyl)pyrimidin-4-amine.
| Compound Name | 2-methyl-N-(2-methylbutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 62769511 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-methyl-N-(2-methylbutyl)pyrimidin-4-amine |
| SMILES | CCC(C)CNc1ccnc(C)n1 |
| InChI | InChI=1S/C10H17N3/c1-4-8(2)7-12-10-5-6-11-9(3)13-10/h5-6,8H,4,7H2,1-3H3,(H,11,12,13) |
| InChIKey | WVCOOJISZNZTQI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |