C9H15N3 — CID 62785690
N-butyl-2-methylpyrimidin-4-amine (PubChem CID 62785690) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is N-butyl-2-methylpyrimidin-4-amine.
| Compound Name | N-butyl-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 62785690 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N-butyl-2-methylpyrimidin-4-amine |
| SMILES | CCCCNc1ccnc(C)n1 |
| InChI | InChI=1S/C9H15N3/c1-3-4-6-11-9-5-7-10-8(2)12-9/h5,7H,3-4,6H2,1-2H3,(H,10,11,12) |
| InChIKey | YLRVMPNHONPJEZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|