C14H26N4 — CID 113336790
2-N-ethyl-4-N-octylpyrimidine-2,4-diamine (PubChem CID 113336790) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-N-ethyl-4-N-octylpyrimidine-2,4-diamine.
| Compound Name | 2-N-ethyl-4-N-octylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 113336790 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 2-N-ethyl-4-N-octylpyrimidine-2,4-diamine |
| SMILES | CCCCCCCCNc1ccnc(NCC)n1 |
| InChI | InChI=1S/C14H26N4/c1-3-5-6-7-8-9-11-16-13-10-12-17-14(18-13)15-4-2/h10,12H,3-9,11H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | AMHDVGIWBZRTMD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|