C7H10FN3 — CID 130478085
N-(2-fluoroethyl)-2-methylpyrimidin-4-amine (PubChem CID 130478085) has the molecular formula C7H10FN3 and a molecular weight of 155.18 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2-methylpyrimidin-4-amine.
| Compound Name | N-(2-fluoroethyl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 130478085 |
| Molecular Formula | C7H10FN3 |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | N-(2-fluoroethyl)-2-methylpyrimidin-4-amine |
| SMILES | Cc1nccc(NCCF)n1 |
| InChI | InChI=1S/C7H10FN3/c1-6-9-4-2-7(11-6)10-5-3-8/h2,4H,3,5H2,1H3,(H,9,10,11) |
| InChIKey | BYQNUQJYLOIWSR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |