C14H25N3 — CID 107816212
2-methyl-N-(7-methyloctyl)pyrimidin-4-amine (PubChem CID 107816212) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-methyl-N-(7-methyloctyl)pyrimidin-4-amine.
| Compound Name | 2-methyl-N-(7-methyloctyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107816212 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-methyl-N-(7-methyloctyl)pyrimidin-4-amine |
| SMILES | Cc1nccc(NCCCCCCC(C)C)n1 |
| InChI | InChI=1S/C14H25N3/c1-12(2)8-6-4-5-7-10-16-14-9-11-15-13(3)17-14/h9,11-12H,4-8,10H2,1-3H3,(H,15,16,17) |
| InChIKey | YENCYVNDSKMUOG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|