C14H25N3 — CID 114004472
6-N-(7-methyloctyl)pyridine-2,6-diamine (PubChem CID 114004472) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 6-N-(7-methyloctyl)pyridine-2,6-diamine.
| Compound Name | 6-N-(7-methyloctyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 114004472 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 6-N-(7-methyloctyl)pyridine-2,6-diamine |
| SMILES | CC(C)CCCCCCNc1cccc(N)n1 |
| InChI | InChI=1S/C14H25N3/c1-12(2)8-5-3-4-6-11-16-14-10-7-9-13(15)17-14/h7,9-10,12H,3-6,8,11H2,1-2H3,(H3,15,16,17) |
| InChIKey | FLJRIQKHHJDKMQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|