C12H19BrN2 — CID 115326764
6-bromo-N-(5-methylhexyl)pyridin-2-amine (PubChem CID 115326764) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 6-bromo-N-(5-methylhexyl)pyridin-2-amine.
| Compound Name | 6-bromo-N-(5-methylhexyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115326764 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 6-bromo-N-(5-methylhexyl)pyridin-2-amine |
| SMILES | CC(C)CCCCNc1cccc(Br)n1 |
| InChI | InChI=1S/C12H19BrN2/c1-10(2)6-3-4-9-14-12-8-5-7-11(13)15-12/h5,7-8,10H,3-4,6,9H2,1-2H3,(H,14,15) |
| InChIKey | XVOOXUYDGDYOLP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|