C12H22N4 — CID 115324674
6-N-(5-methylhexyl)pyridine-2,3,6-triamine (PubChem CID 115324674) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 6-N-(5-methylhexyl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-(5-methylhexyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 115324674 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 6-N-(5-methylhexyl)pyridine-2,3,6-triamine |
| SMILES | CC(C)CCCCNc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C12H22N4/c1-9(2)5-3-4-8-15-11-7-6-10(13)12(14)16-11/h6-7,9H,3-5,8,13H2,1-2H3,(H3,14,15,16) |
| InChIKey | QHGOFSHCGIOLMM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|