C7H12N4 — CID 79822372
6-N-ethylpyridine-2,3,6-triamine (PubChem CID 79822372) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 6-N-ethylpyridine-2,3,6-triamine.
| Compound Name | 6-N-ethylpyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79822372 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 6-N-ethylpyridine-2,3,6-triamine |
| SMILES | CCNc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C7H12N4/c1-2-10-6-4-3-5(8)7(9)11-6/h3-4H,2,8H2,1H3,(H3,9,10,11) |
| InChIKey | HLTZPFLGTRUVMG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |