C11H21N5 — CID 79822537
6-N-[2-(diethylamino)ethyl]pyridine-2,3,6-triamine (PubChem CID 79822537) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 6-N-[2-(diethylamino)ethyl]pyridine-2,3,6-triamine.
| Compound Name | 6-N-[2-(diethylamino)ethyl]pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79822537 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 6-N-[2-(diethylamino)ethyl]pyridine-2,3,6-triamine |
| SMILES | CCN(CC)CCNc1ccc(N)c(N)n1 |
| InChI | InChI=1S/C11H21N5/c1-3-16(4-2)8-7-14-10-6-5-9(12)11(13)15-10/h5-6H,3-4,7-8,12H2,1-2H3,(H3,13,14,15) |
| InChIKey | ZCFVORRDMMMYBM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |