C15H21N3 — CID 29034391
N',N'-diethyl-N-quinolin-2-ylethane-1,2-diamine (PubChem CID 29034391) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N',N'-diethyl-N-quinolin-2-ylethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-quinolin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 29034391 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N',N'-diethyl-N-quinolin-2-ylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H21N3/c1-3-18(4-2)12-11-16-15-10-9-13-7-5-6-8-14(13)17-15/h5-10H,3-4,11-12H2,1-2H3,(H,16,17) |
| InChIKey | UPLGKPZWFWQQSF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |