About N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine
N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 133381320) has the molecular formula C15H20ClN3
and a molecular weight of 277.80 g/mol. Its IUPAC name is N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine |
| PubChem CID | 133381320 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1cc2ccccc2c(Cl)n1 |
| InChI | InChI=1S/C15H20ClN3/c1-3-19(4-2)10-9-17-14-11-12-7-5-6-8-13(12)15(16)18-14/h5-8,11H,3-4,9-10H2,1-2H3,(H,17,18) |
| InChIKey | CLZYVNOJFXDAKP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine?
The IUPAC name of N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine (CID 133381320) is N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine.
What is the SMILES notation for N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine?
The canonical SMILES for N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine is CCN(CC)CCNc1cc2ccccc2c(Cl)n1.
What is the InChIKey of N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine?
The InChIKey is CLZYVNOJFXDAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClN3/c1-3-19(4-2)10-9-17-14-11-12-7-5-6-8-13(12)15(16)18-14/h5-8,11H,3-4,9-10H2,1-2H3,(H,17,18).
What are the key properties of N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine?
N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine has a molecular weight of 277.80 g/mol, XLogP of 3.64, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-chloroisoquinolin-3-yl)-N',N'-diethylethane-1,2-diamine is sourced from PubChem (CID 133381320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).