C17H29Cl2N3O — CID 67663946
N',N'-diethyl-N-(4-methylquinolin-2-yl)propane-1,3-diamine;hydrate;dihydrochloride (PubChem CID 67663946) has the molecular formula C17H29Cl2N3O and a molecular weight of 362.35 g/mol. Its IUPAC name is N',N'-diethyl-N-(4-methylquinolin-2-yl)propane-1,3-diamine;hydrate;dihydrochloride.
| Compound Name | N',N'-diethyl-N-(4-methylquinolin-2-yl)propane-1,3-diamine;hydrate;dihydrochloride |
|---|---|
| PubChem CID | 67663946 |
| Molecular Formula | C17H29Cl2N3O |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N',N'-diethyl-N-(4-methylquinolin-2-yl)propane-1,3-diamine;hydrate;dihydrochloride |
| SMILES | CCN(CC)CCCNc1cc(C)c2ccccc2n1.Cl.Cl.O |
| InChI | InChI=1S/C17H25N3.2ClH.H2O/c1-4-20(5-2)12-8-11-18-17-13-14(3)15-9-6-7-10-16(15)19-17;;;/h6-7,9-10,13H,4-5,8,11-12H2,1-3H3,(H,18,19);2*1H;1H2 |
| InChIKey | ZCUDZNMOSOKTSM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|