C18H27N3 — CID 78943020
N',N'-diethyl-N-[(2-methylquinolin-4-yl)methyl]propane-1,3-diamine (PubChem CID 78943020) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is N',N'-diethyl-N-[(2-methylquinolin-4-yl)methyl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[(2-methylquinolin-4-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 78943020 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N',N'-diethyl-N-[(2-methylquinolin-4-yl)methyl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1cc(C)nc2ccccc12 |
| InChI | InChI=1S/C18H27N3/c1-4-21(5-2)12-8-11-19-14-16-13-15(3)20-18-10-7-6-9-17(16)18/h6-7,9-10,13,19H,4-5,8,11-12,14H2,1-3H3 |
| InChIKey | KACBAMGWUKFLMC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|