C15H21N3 — CID 113405208
N-ethyl-N'-[(2-methylquinolin-4-yl)methyl]ethane-1,2-diamine (PubChem CID 113405208) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-ethyl-N'-[(2-methylquinolin-4-yl)methyl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-[(2-methylquinolin-4-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 113405208 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-ethyl-N'-[(2-methylquinolin-4-yl)methyl]ethane-1,2-diamine |
| SMILES | CCNCCNCc1cc(C)nc2ccccc12 |
| InChI | InChI=1S/C15H21N3/c1-3-16-8-9-17-11-13-10-12(2)18-15-7-5-4-6-14(13)15/h4-7,10,16-17H,3,8-9,11H2,1-2H3 |
| InChIKey | OEEFIHVIXMNZTR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|