C19H29N3 — CID 112810281
1-N,1-N-diethyl-4-N-(2-methylquinolin-4-yl)pentane-1,4-diamine (PubChem CID 112810281) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-(2-methylquinolin-4-yl)pentane-1,4-diamine.
| Compound Name | 1-N,1-N-diethyl-4-N-(2-methylquinolin-4-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 112810281 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-(2-methylquinolin-4-yl)pentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1cc(C)nc2ccccc12 |
| InChI | InChI=1S/C19H29N3/c1-5-22(6-2)13-9-10-15(3)20-19-14-16(4)21-18-12-8-7-11-17(18)19/h7-8,11-12,14-15H,5-6,9-10,13H2,1-4H3,(H,20,21) |
| InChIKey | IZNZCUVAAPISHP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |