C19H28N2 — CID 129412307
(4R)-1-N,1-N-diethyl-4-N-naphthalen-1-ylpentane-1,4-diamine (PubChem CID 129412307) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is (4R)-1-N,1-N-diethyl-4-N-naphthalen-1-ylpentane-1,4-diamine.
| Compound Name | (4R)-1-N,1-N-diethyl-4-N-naphthalen-1-ylpentane-1,4-diamine |
|---|---|
| PubChem CID | 129412307 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | (4R)-1-N,1-N-diethyl-4-N-naphthalen-1-ylpentane-1,4-diamine |
| SMILES | CCN(CC)CCC[C@@H](C)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H28N2/c1-4-21(5-2)15-9-10-16(3)20-19-14-8-12-17-11-6-7-13-18(17)19/h6-8,11-14,16,20H,4-5,9-10,15H2,1-3H3/t16-/m1/s1 |
| InChIKey | HCFQEJYDIGWVOB-MRXNPFEDSA-N |
| XLogP | 4.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |