C14H25N3 — CID 40545835
(4R)-1-N,1-N-diethyl-4-N-pyridin-2-ylpentane-1,4-diamine (PubChem CID 40545835) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is (4R)-1-N,1-N-diethyl-4-N-pyridin-2-ylpentane-1,4-diamine.
| Compound Name | (4R)-1-N,1-N-diethyl-4-N-pyridin-2-ylpentane-1,4-diamine |
|---|---|
| PubChem CID | 40545835 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (4R)-1-N,1-N-diethyl-4-N-pyridin-2-ylpentane-1,4-diamine |
| SMILES | CCN(CC)CCC[C@@H](C)Nc1ccccn1 |
| InChI | InChI=1S/C14H25N3/c1-4-17(5-2)12-8-9-13(3)16-14-10-6-7-11-15-14/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3,(H,15,16)/t13-/m1/s1 |
| InChIKey | APSIOSFIDTXPHC-CYBMUJFWSA-N |
| XLogP | 3.00 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |