C18H27N3 — CID 36691119
(4S)-1-N,1-N-diethyl-4-N-quinolin-2-ylpentane-1,4-diamine (PubChem CID 36691119) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is (4S)-1-N,1-N-diethyl-4-N-quinolin-2-ylpentane-1,4-diamine.
| Compound Name | (4S)-1-N,1-N-diethyl-4-N-quinolin-2-ylpentane-1,4-diamine |
|---|---|
| PubChem CID | 36691119 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (4S)-1-N,1-N-diethyl-4-N-quinolin-2-ylpentane-1,4-diamine |
| SMILES | CCN(CC)CCC[C@H](C)Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H27N3/c1-4-21(5-2)14-8-9-15(3)19-18-13-12-16-10-6-7-11-17(16)20-18/h6-7,10-13,15H,4-5,8-9,14H2,1-3H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | GEQQWZVVWXHOCJ-HNNXBMFYSA-N |
| XLogP | 4.16 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |