C22H28ClN3 — CID 23422070
4-N-(3-chloroacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 23422070) has the molecular formula C22H28ClN3 and a molecular weight of 369.94 g/mol. Its IUPAC name is 4-N-(3-chloroacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | 4-N-(3-chloroacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 23422070 |
| Molecular Formula | C22H28ClN3 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 4-N-(3-chloroacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)Nc1c2ccccc2nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C22H28ClN3/c1-4-26(5-2)14-8-9-16(3)24-22-18-10-6-7-11-20(18)25-21-15-17(23)12-13-19(21)22/h6-7,10-13,15-16H,4-5,8-9,14H2,1-3H3,(H,24,25) |
| InChIKey | YDSJOXQUGFFAKB-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|