C27H40ClN3O — CID 176972900
butane;4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine (PubChem CID 176972900) has the molecular formula C27H40ClN3O and a molecular weight of 458.09 g/mol. Its IUPAC name is butane;4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine.
| Compound Name | butane;4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 176972900 |
| Molecular Formula | C27H40ClN3O |
| Molecular Weight | 458.09 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | butane;4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| SMILES | CCCC.CCN(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C23H30ClN3O.C4H10/c1-5-27(6-2)13-7-8-16(3)25-23-19-11-9-17(24)14-22(19)26-21-12-10-18(28-4)15-20(21)23;1-3-4-2/h9-12,14-16H,5-8,13H2,1-4H3,(H,25,26);3-4H2,1-2H3 |
| InChIKey | RAIMEOLPKQCWFA-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.09 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|