C26H37Cl2N3O — CID 44531335
5-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-dipropylhexane-1,5-diamine;hydrochloride (PubChem CID 44531335) has the molecular formula C26H37Cl2N3O and a molecular weight of 478.51 g/mol. Its IUPAC name is 5-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-dipropylhexane-1,5-diamine;hydrochloride.
| Compound Name | 5-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-dipropylhexane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 44531335 |
| Molecular Formula | C26H37Cl2N3O |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 5-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-dipropylhexane-1,5-diamine;hydrochloride |
| SMILES | CCCN(CCC)CCCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12.Cl |
| InChI | InChI=1S/C26H36ClN3O.ClH/c1-5-14-30(15-6-2)16-8-7-9-19(3)28-26-22-12-10-20(27)17-25(22)29-24-13-11-21(31-4)18-23(24)26;/h10-13,17-19H,5-9,14-16H2,1-4H3,(H,28,29);1H |
| InChIKey | PFAVEFCRPZTKSU-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|