C24H31ClN2O — CID 20753270
6-chloro-N-(6-ethyloctan-2-yl)-2-methoxyacridin-9-amine (PubChem CID 20753270) has the molecular formula C24H31ClN2O and a molecular weight of 398.98 g/mol. Its IUPAC name is 6-chloro-N-(6-ethyloctan-2-yl)-2-methoxyacridin-9-amine.
| Compound Name | 6-chloro-N-(6-ethyloctan-2-yl)-2-methoxyacridin-9-amine |
|---|---|
| PubChem CID | 20753270 |
| Molecular Formula | C24H31ClN2O |
| Molecular Weight | 398.98 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 6-chloro-N-(6-ethyloctan-2-yl)-2-methoxyacridin-9-amine |
| SMILES | CCC(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C24H31ClN2O/c1-5-17(6-2)9-7-8-16(3)26-24-20-12-10-18(25)14-23(20)27-22-13-11-19(28-4)15-21(22)24/h10-17H,5-9H2,1-4H3,(H,26,27) |
| InChIKey | JXUDCWNCWRFXEM-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.98 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|