C22H31ClN2O — CID 166169543
N-butyl-6-chloro-2-methoxyacridin-9-amine;ethane (PubChem CID 166169543) has the molecular formula C22H31ClN2O and a molecular weight of 374.96 g/mol. Its IUPAC name is N-butyl-6-chloro-2-methoxyacridin-9-amine;ethane.
| Compound Name | N-butyl-6-chloro-2-methoxyacridin-9-amine;ethane |
|---|---|
| PubChem CID | 166169543 |
| Molecular Formula | C22H31ClN2O |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N-butyl-6-chloro-2-methoxyacridin-9-amine;ethane |
| SMILES | CC.CC.CCCCNc1c2ccc(Cl)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C18H19ClN2O.2C2H6/c1-3-4-9-20-18-14-7-5-12(19)10-17(14)21-16-8-6-13(22-2)11-15(16)18;2*1-2/h5-8,10-11H,3-4,9H2,1-2H3,(H,20,21);2*1-2H3 |
| InChIKey | FBLCPHBVEKLCGU-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|