About N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine
N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine (PubChem CID 511167) has the molecular formula C21H26ClN3O
and a molecular weight of 371.91 g/mol. Its IUPAC name is N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine.
Molecular Properties
| Compound Name | N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine |
| PubChem CID | 511167 |
| Molecular Formula | C21H26ClN3O |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCCCCCN)c2c1 |
| InChI | InChI=1S/C21H26ClN3O/c1-26-16-8-10-19-18(14-16)21(24-12-6-4-2-3-5-11-23)17-9-7-15(22)13-20(17)25-19/h7-10,13-14H,2-6,11-12,23H2,1H3,(H,24,25) |
| InChIKey | DJMCJIRSZMPUDK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine?
The IUPAC name of N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine (CID 511167) is N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine.
What is the SMILES notation for N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine?
The canonical SMILES for N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine is COc1ccc2nc3cc(Cl)ccc3c(NCCCCCCCN)c2c1.
What is the InChIKey of N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine?
The InChIKey is DJMCJIRSZMPUDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26ClN3O/c1-26-16-8-10-19-18(14-16)21(24-12-6-4-2-3-5-11-23)17-9-7-15(22)13-20(17)25-19/h7-10,13-14H,2-6,11-12,23H2,1H3,(H,24,25).
What are the key properties of N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine?
N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine has a molecular weight of 371.91 g/mol, XLogP of 5.37, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(6-chloro-2-methoxyacridin-9-yl)heptane-1,7-diamine is sourced from PubChem (CID 511167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).