C24H32ClN3O — CID 15329153
N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethylhexane-1,6-diamine (PubChem CID 15329153) has the molecular formula C24H32ClN3O and a molecular weight of 413.99 g/mol. Its IUPAC name is N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethylhexane-1,6-diamine.
| Compound Name | N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethylhexane-1,6-diamine |
|---|---|
| PubChem CID | 15329153 |
| Molecular Formula | C24H32ClN3O |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethylhexane-1,6-diamine |
| SMILES | CCN(CC)CCCCCCNc1c2ccc(Cl)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C24H32ClN3O/c1-4-28(5-2)15-9-7-6-8-14-26-24-20-12-10-18(25)16-23(20)27-22-13-11-19(29-3)17-21(22)24/h10-13,16-17H,4-9,14-15H2,1-3H3,(H,26,27) |
| InChIKey | AKMRCRSBVXSYQI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|