C23H30ClN3O — CID 71471687
N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethyl-N-methylbutane-1,4-diamine (PubChem CID 71471687) has the molecular formula C23H30ClN3O and a molecular weight of 399.97 g/mol. Its IUPAC name is N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethyl-N-methylbutane-1,4-diamine.
| Compound Name | N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethyl-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 71471687 |
| Molecular Formula | C23H30ClN3O |
| Molecular Weight | 399.97 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-diethyl-N-methylbutane-1,4-diamine |
| SMILES | CCN(CC)CCCCN(C)c1c2ccc(Cl)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C23H30ClN3O/c1-5-27(6-2)14-8-7-13-26(3)23-19-11-9-17(24)15-22(19)25-21-12-10-18(28-4)16-20(21)23/h9-12,15-16H,5-8,13-14H2,1-4H3 |
| InChIKey | OJPRFHWXQYPJEG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.97 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|