C22H27ClN2OS — CID 10431251
4-(6-chloro-2-methoxyacridin-9-yl)sulfanyl-N,N-diethylbutan-1-amine (PubChem CID 10431251) has the molecular formula C22H27ClN2OS and a molecular weight of 402.99 g/mol. Its IUPAC name is 4-(6-chloro-2-methoxyacridin-9-yl)sulfanyl-N,N-diethylbutan-1-amine.
| Compound Name | 4-(6-chloro-2-methoxyacridin-9-yl)sulfanyl-N,N-diethylbutan-1-amine |
|---|---|
| PubChem CID | 10431251 |
| Molecular Formula | C22H27ClN2OS |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 4-(6-chloro-2-methoxyacridin-9-yl)sulfanyl-N,N-diethylbutan-1-amine |
| SMILES | CCN(CC)CCCCSc1c2ccc(Cl)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C22H27ClN2OS/c1-4-25(5-2)12-6-7-13-27-22-18-10-8-16(23)14-21(18)24-20-11-9-17(26-3)15-19(20)22/h8-11,14-15H,4-7,12-13H2,1-3H3 |
| InChIKey | RIQDQOLVJKPUKG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|