C19H22N2O2S — CID 53475819
3-(2,7-dimethoxyacridin-9-yl)sulfanyl-N-methylpropan-1-amine (PubChem CID 53475819) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 3-(2,7-dimethoxyacridin-9-yl)sulfanyl-N-methylpropan-1-amine.
| Compound Name | 3-(2,7-dimethoxyacridin-9-yl)sulfanyl-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 53475819 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 3-(2,7-dimethoxyacridin-9-yl)sulfanyl-N-methylpropan-1-amine |
| SMILES | CNCCCSc1c2cc(OC)ccc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C19H22N2O2S/c1-20-9-4-10-24-19-15-11-13(22-2)5-7-17(15)21-18-8-6-14(23-3)12-16(18)19/h5-8,11-12,20H,4,9-10H2,1-3H3 |
| InChIKey | IAHSURMWFSPKKC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|