C18H21ClN2O2S — CID 71699942
3-(2,7-dimethoxyacridin-9-yl)sulfanylpropan-1-amine;hydrochloride (PubChem CID 71699942) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is 3-(2,7-dimethoxyacridin-9-yl)sulfanylpropan-1-amine;hydrochloride.
| Compound Name | 3-(2,7-dimethoxyacridin-9-yl)sulfanylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 71699942 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-(2,7-dimethoxyacridin-9-yl)sulfanylpropan-1-amine;hydrochloride |
| SMILES | COc1ccc2nc3ccc(OC)cc3c(SCCCN)c2c1.Cl |
| InChI | InChI=1S/C18H20N2O2S.ClH/c1-21-12-4-6-16-14(10-12)18(23-9-3-8-19)15-11-13(22-2)5-7-17(15)20-16;/h4-7,10-11H,3,8-9,19H2,1-2H3;1H |
| InChIKey | YWEKJJDSEKWGPQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|