C18H20N2O3 — CID 53475922
3-(2,7-dimethoxyacridin-9-yl)oxypropan-1-amine (PubChem CID 53475922) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(2,7-dimethoxyacridin-9-yl)oxypropan-1-amine.
| Compound Name | 3-(2,7-dimethoxyacridin-9-yl)oxypropan-1-amine |
|---|---|
| PubChem CID | 53475922 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-(2,7-dimethoxyacridin-9-yl)oxypropan-1-amine |
| SMILES | COc1ccc2nc3ccc(OC)cc3c(OCCCN)c2c1 |
| InChI | InChI=1S/C18H20N2O3/c1-21-12-4-6-16-14(10-12)18(23-9-3-8-19)15-11-13(22-2)5-7-17(15)20-16/h4-7,10-11H,3,8-9,19H2,1-2H3 |
| InChIKey | XSGCWAWKGDDDGL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|