C12H13NO2 — CID 123803220
6-methoxy-2,4-dimethylquinolin-3-ol (PubChem CID 123803220) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 6-methoxy-2,4-dimethylquinolin-3-ol.
| Compound Name | 6-methoxy-2,4-dimethylquinolin-3-ol |
|---|---|
| PubChem CID | 123803220 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 6-methoxy-2,4-dimethylquinolin-3-ol |
| SMILES | COc1ccc2nc(C)c(O)c(C)c2c1 |
| InChI | InChI=1S/C12H13NO2/c1-7-10-6-9(15-3)4-5-11(10)13-8(2)12(7)14/h4-6,14H,1-3H3 |
| InChIKey | MKMOODGRUATTCE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |