C14H19NO — CID 143681558
ethane;6-methoxy-2,4-dimethylquinoline (PubChem CID 143681558) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is ethane;6-methoxy-2,4-dimethylquinoline.
| Compound Name | ethane;6-methoxy-2,4-dimethylquinoline |
|---|---|
| PubChem CID | 143681558 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | ethane;6-methoxy-2,4-dimethylquinoline |
| SMILES | CC.COc1ccc2nc(C)cc(C)c2c1 |
| InChI | InChI=1S/C12H13NO.C2H6/c1-8-6-9(2)13-12-5-4-10(14-3)7-11(8)12;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | JXNVEXZRCBCGPE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |