C15H22FN — CID 142222878
ethane;6-fluoro-2,4-dimethylquinoline (PubChem CID 142222878) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is ethane;6-fluoro-2,4-dimethylquinoline.
| Compound Name | ethane;6-fluoro-2,4-dimethylquinoline |
|---|---|
| PubChem CID | 142222878 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | ethane;6-fluoro-2,4-dimethylquinoline |
| SMILES | CC.CC.Cc1cc(C)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C11H10FN.2C2H6/c1-7-5-8(2)13-11-4-3-9(12)6-10(7)11;2*1-2/h3-6H,1-2H3;2*1-2H3 |
| InChIKey | LTUXIWXYXRAPNQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |