C12H11F3N2 — CID 133368446
N-(2,2-difluoroethyl)-6-fluoro-2-methylquinolin-4-amine (PubChem CID 133368446) has the molecular formula C12H11F3N2 and a molecular weight of 240.23 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-6-fluoro-2-methylquinolin-4-amine.
| Compound Name | N-(2,2-difluoroethyl)-6-fluoro-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 133368446 |
| Molecular Formula | C12H11F3N2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-(2,2-difluoroethyl)-6-fluoro-2-methylquinolin-4-amine |
| SMILES | Cc1cc(NCC(F)F)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C12H11F3N2/c1-7-4-11(16-6-12(14)15)9-5-8(13)2-3-10(9)17-7/h2-5,12H,6H2,1H3,(H,16,17) |
| InChIKey | CLMMLCAKDDYJND-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |