C17H21FN2O — CID 133394062
1-cyclopentyl-2-[(6-fluoro-2-methylquinolin-4-yl)amino]ethanol (PubChem CID 133394062) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(6-fluoro-2-methylquinolin-4-yl)amino]ethanol.
| Compound Name | 1-cyclopentyl-2-[(6-fluoro-2-methylquinolin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 133394062 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-cyclopentyl-2-[(6-fluoro-2-methylquinolin-4-yl)amino]ethanol |
| SMILES | Cc1cc(NCC(O)C2CCCC2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C17H21FN2O/c1-11-8-16(14-9-13(18)6-7-15(14)20-11)19-10-17(21)12-4-2-3-5-12/h6-9,12,17,21H,2-5,10H2,1H3,(H,19,20) |
| InChIKey | BRNITCZSDZGPKM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |