C17H21FN2O2S — CID 133394331
6-fluoro-2-methyl-N-(3-methylsulfonylcyclohexyl)quinolin-4-amine (PubChem CID 133394331) has the molecular formula C17H21FN2O2S and a molecular weight of 336.43 g/mol. Its IUPAC name is 6-fluoro-2-methyl-N-(3-methylsulfonylcyclohexyl)quinolin-4-amine.
| Compound Name | 6-fluoro-2-methyl-N-(3-methylsulfonylcyclohexyl)quinolin-4-amine |
|---|---|
| PubChem CID | 133394331 |
| Molecular Formula | C17H21FN2O2S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 6-fluoro-2-methyl-N-(3-methylsulfonylcyclohexyl)quinolin-4-amine |
| SMILES | Cc1cc(NC2CCCC(S(C)(=O)=O)C2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C17H21FN2O2S/c1-11-8-17(15-9-12(18)6-7-16(15)19-11)20-13-4-3-5-14(10-13)23(2,21)22/h6-9,13-14H,3-5,10H2,1-2H3,(H,19,20) |
| InChIKey | ROQHYMVLAMUZKY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |