C14H19F2NO2S — CID 103585711
2,5-difluoro-4-methyl-N-(3-methylsulfonylcyclohexyl)aniline (PubChem CID 103585711) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is 2,5-difluoro-4-methyl-N-(3-methylsulfonylcyclohexyl)aniline.
| Compound Name | 2,5-difluoro-4-methyl-N-(3-methylsulfonylcyclohexyl)aniline |
|---|---|
| PubChem CID | 103585711 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2,5-difluoro-4-methyl-N-(3-methylsulfonylcyclohexyl)aniline |
| SMILES | Cc1cc(F)c(NC2CCCC(S(C)(=O)=O)C2)cc1F |
| InChI | InChI=1S/C14H19F2NO2S/c1-9-6-13(16)14(8-12(9)15)17-10-4-3-5-11(7-10)20(2,18)19/h6,8,10-11,17H,3-5,7H2,1-2H3 |
| InChIKey | QGTQQVBYWKSLLB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |