C15H19FO3S — CID 115786050
(2-fluoro-5-methylphenyl)-(3-methylsulfonylcyclohexyl)methanone (PubChem CID 115786050) has the molecular formula C15H19FO3S and a molecular weight of 298.38 g/mol. Its IUPAC name is (2-fluoro-5-methylphenyl)-(3-methylsulfonylcyclohexyl)methanone.
| Compound Name | (2-fluoro-5-methylphenyl)-(3-methylsulfonylcyclohexyl)methanone |
|---|---|
| PubChem CID | 115786050 |
| Molecular Formula | C15H19FO3S |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (2-fluoro-5-methylphenyl)-(3-methylsulfonylcyclohexyl)methanone |
| SMILES | Cc1ccc(F)c(C(=O)C2CCCC(S(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C15H19FO3S/c1-10-6-7-14(16)13(8-10)15(17)11-4-3-5-12(9-11)20(2,18)19/h6-8,11-12H,3-5,9H2,1-2H3 |
| InChIKey | GKXIKTJHYXYKFV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |