C14H16BrFO3S — CID 107957262
(3-bromo-2-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanone (PubChem CID 107957262) has the molecular formula C14H16BrFO3S and a molecular weight of 363.25 g/mol. Its IUPAC name is (3-bromo-2-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanone.
| Compound Name | (3-bromo-2-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanone |
|---|---|
| PubChem CID | 107957262 |
| Molecular Formula | C14H16BrFO3S |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | (3-bromo-2-fluorophenyl)-(3-methylsulfonylcyclohexyl)methanone |
| SMILES | CS(=O)(=O)C1CCCC(C(=O)c2cccc(Br)c2F)C1 |
| InChI | InChI=1S/C14H16BrFO3S/c1-20(18,19)10-5-2-4-9(8-10)14(17)11-6-3-7-12(15)13(11)16/h3,6-7,9-10H,2,4-5,8H2,1H3 |
| InChIKey | ANHUEJFQKSCMAY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |