C16H21BrO — CID 114976475
(3-bromo-2-methylphenyl)-(3-ethylcyclohexyl)methanone (PubChem CID 114976475) has the molecular formula C16H21BrO and a molecular weight of 309.25 g/mol. Its IUPAC name is (3-bromo-2-methylphenyl)-(3-ethylcyclohexyl)methanone.
| Compound Name | (3-bromo-2-methylphenyl)-(3-ethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 114976475 |
| Molecular Formula | C16H21BrO |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (3-bromo-2-methylphenyl)-(3-ethylcyclohexyl)methanone |
| SMILES | CCC1CCCC(C(=O)c2cccc(Br)c2C)C1 |
| InChI | InChI=1S/C16H21BrO/c1-3-12-6-4-7-13(10-12)16(18)14-8-5-9-15(17)11(14)2/h5,8-9,12-13H,3-4,6-7,10H2,1-2H3 |
| InChIKey | PNMRIXBISOPYJV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |