C16H21FO2 — CID 82808493
(3-ethylcyclohexyl)-(2-fluoro-3-methoxyphenyl)methanone (PubChem CID 82808493) has the molecular formula C16H21FO2 and a molecular weight of 264.34 g/mol. Its IUPAC name is (3-ethylcyclohexyl)-(2-fluoro-3-methoxyphenyl)methanone.
| Compound Name | (3-ethylcyclohexyl)-(2-fluoro-3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 82808493 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (3-ethylcyclohexyl)-(2-fluoro-3-methoxyphenyl)methanone |
| SMILES | CCC1CCCC(C(=O)c2cccc(OC)c2F)C1 |
| InChI | InChI=1S/C16H21FO2/c1-3-11-6-4-7-12(10-11)16(18)13-8-5-9-14(19-2)15(13)17/h5,8-9,11-12H,3-4,6-7,10H2,1-2H3 |
| InChIKey | NEOWLSCKAJIIGJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |