C15H21BrO3S — CID 115822100
(3-bromo-2-methylphenyl)-(3-methylsulfonylcyclohexyl)methanol (PubChem CID 115822100) has the molecular formula C15H21BrO3S and a molecular weight of 361.30 g/mol. Its IUPAC name is (3-bromo-2-methylphenyl)-(3-methylsulfonylcyclohexyl)methanol.
| Compound Name | (3-bromo-2-methylphenyl)-(3-methylsulfonylcyclohexyl)methanol |
|---|---|
| PubChem CID | 115822100 |
| Molecular Formula | C15H21BrO3S |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | (3-bromo-2-methylphenyl)-(3-methylsulfonylcyclohexyl)methanol |
| SMILES | Cc1c(Br)cccc1C(O)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H21BrO3S/c1-10-13(7-4-8-14(10)16)15(17)11-5-3-6-12(9-11)20(2,18)19/h4,7-8,11-12,15,17H,3,5-6,9H2,1-2H3 |
| InChIKey | CKYNNTHAEYDETQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |