C15H22BrNO2S — CID 107985228
(2-bromo-3-methylphenyl)-(3-methylsulfonylcyclohexyl)methanamine (PubChem CID 107985228) has the molecular formula C15H22BrNO2S and a molecular weight of 360.32 g/mol. Its IUPAC name is (2-bromo-3-methylphenyl)-(3-methylsulfonylcyclohexyl)methanamine.
| Compound Name | (2-bromo-3-methylphenyl)-(3-methylsulfonylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 107985228 |
| Molecular Formula | C15H22BrNO2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (2-bromo-3-methylphenyl)-(3-methylsulfonylcyclohexyl)methanamine |
| SMILES | Cc1cccc(C(N)C2CCCC(S(C)(=O)=O)C2)c1Br |
| InChI | InChI=1S/C15H22BrNO2S/c1-10-5-3-8-13(14(10)16)15(17)11-6-4-7-12(9-11)20(2,18)19/h3,5,8,11-12,15H,4,6-7,9,17H2,1-2H3 |
| InChIKey | YTZRKFQXYIUWFG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |