C13H20BrNO2S2 — CID 105014349
(5-bromo-4-methylthiophen-2-yl)-(3-methylsulfonylcyclohexyl)methanamine (PubChem CID 105014349) has the molecular formula C13H20BrNO2S2 and a molecular weight of 366.35 g/mol. Its IUPAC name is (5-bromo-4-methylthiophen-2-yl)-(3-methylsulfonylcyclohexyl)methanamine.
| Compound Name | (5-bromo-4-methylthiophen-2-yl)-(3-methylsulfonylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 105014349 |
| Molecular Formula | C13H20BrNO2S2 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | (5-bromo-4-methylthiophen-2-yl)-(3-methylsulfonylcyclohexyl)methanamine |
| SMILES | Cc1cc(C(N)C2CCCC(S(C)(=O)=O)C2)sc1Br |
| InChI | InChI=1S/C13H20BrNO2S2/c1-8-6-11(18-13(8)14)12(15)9-4-3-5-10(7-9)19(2,16)17/h6,9-10,12H,3-5,7,15H2,1-2H3 |
| InChIKey | DHOMLJVGSUBNNJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |