C11H18BrClN2S — CID 171314278
(R)-(5-bromo-4-methylthiophen-2-yl)-piperidin-4-ylmethanamine;hydrochloride (PubChem CID 171314278) has the molecular formula C11H18BrClN2S and a molecular weight of 325.70 g/mol. Its IUPAC name is (R)-(5-bromo-4-methylthiophen-2-yl)-piperidin-4-ylmethanamine;hydrochloride.
| Compound Name | (R)-(5-bromo-4-methylthiophen-2-yl)-piperidin-4-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171314278 |
| Molecular Formula | C11H18BrClN2S |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | (R)-(5-bromo-4-methylthiophen-2-yl)-piperidin-4-ylmethanamine;hydrochloride |
| SMILES | Cc1cc([C@H](N)C2CCNCC2)sc1Br.Cl |
| InChI | InChI=1S/C11H17BrN2S.ClH/c1-7-6-9(15-11(7)12)10(13)8-2-4-14-5-3-8;/h6,8,10,14H,2-5,13H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | FXTYHLIIZIBMPF-HNCPQSOCSA-N |
| XLogP | 3.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |