C9H11Br2NS — CID 80533020
cyclobutyl-(4,5-dibromothiophen-2-yl)methanamine (PubChem CID 80533020) has the molecular formula C9H11Br2NS and a molecular weight of 325.07 g/mol. Its IUPAC name is cyclobutyl-(4,5-dibromothiophen-2-yl)methanamine.
| Compound Name | cyclobutyl-(4,5-dibromothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 80533020 |
| Molecular Formula | C9H11Br2NS |
| Molecular Weight | 325.07 g/mol |
| Exact Mass | 322.90 |
| IUPAC Name | cyclobutyl-(4,5-dibromothiophen-2-yl)methanamine |
| SMILES | NC(c1cc(Br)c(Br)s1)C1CCC1 |
| InChI | InChI=1S/C9H11Br2NS/c10-6-4-7(13-9(6)11)8(12)5-2-1-3-5/h4-5,8H,1-3,12H2 |
| InChIKey | CHDIXVHIOQLBDC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.07 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |