C13H19Br2NS — CID 114457744
2-cycloheptyl-1-(4,5-dibromothiophen-2-yl)ethanamine (PubChem CID 114457744) has the molecular formula C13H19Br2NS and a molecular weight of 381.18 g/mol. Its IUPAC name is 2-cycloheptyl-1-(4,5-dibromothiophen-2-yl)ethanamine.
| Compound Name | 2-cycloheptyl-1-(4,5-dibromothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 114457744 |
| Molecular Formula | C13H19Br2NS |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 2-cycloheptyl-1-(4,5-dibromothiophen-2-yl)ethanamine |
| SMILES | NC(CC1CCCCCC1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H19Br2NS/c14-10-8-12(17-13(10)15)11(16)7-9-5-3-1-2-4-6-9/h8-9,11H,1-7,16H2 |
| InChIKey | PCXNGHRXKPQZKQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |