C6H7Br2NOS — CID 103846013
2-amino-2-(4,5-dibromothiophen-2-yl)ethanol (PubChem CID 103846013) has the molecular formula C6H7Br2NOS and a molecular weight of 301.00 g/mol. Its IUPAC name is 2-amino-2-(4,5-dibromothiophen-2-yl)ethanol.
| Compound Name | 2-amino-2-(4,5-dibromothiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 103846013 |
| Molecular Formula | C6H7Br2NOS |
| Molecular Weight | 301.00 g/mol |
| Exact Mass | 298.86 |
| IUPAC Name | 2-amino-2-(4,5-dibromothiophen-2-yl)ethanol |
| SMILES | NC(CO)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C6H7Br2NOS/c7-3-1-5(4(9)2-10)11-6(3)8/h1,4,10H,2,9H2 |
| InChIKey | XMPBBMFTPRICNE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.00 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |